"Amisülpirid" sayfasının sürümleri arasındaki fark

k
Bilgi kutusu ekleme
k (düzenleme AWB ile)
k (Bilgi kutusu ekleme)
{{İlaç bilgi kutusu
| ilaç_adı = Solian
<!---------- Resimler ----------->
| resim = Amisulpride.svg
| resim_boyutu = 250px
| resim_açıklama =
| resim2 = Amisulpride-xtal-1990-ball-and-stick-model.png
| resim2_boyutu =250px
| resim2_açıklama =
<!-------- Sistematik ad -------->
| iupac_adı = 4-amino-''N''-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide
<!----- Kimlik belirteçleri ----->
| cas_numarası =
| atc_kodu = {{ATC kodu|N05|AL05}}
| pubchem_sayısı = 2159
| drugbank_kodu = DB06288
<!----- Kimyasal özellikler ----->
| kimyasal_formül = {{Hill sistemi
| C=17 | H=27 | N=3 | O=4 | S=1 | Cl = | F =
| Na = | P = | Pt = }}
| moleküler_ağırlık = 369.48 g/mol
| smiles = O=S(=O)(c1cc(c(OC)cc1N)C(=O)NCC2N(CC)CCC2)CC
<!----- Fiziksel özellikler ----->
| yoğunluk =
| ergime_noktası =
| ergime_not =
| kaynama_noktası =
| kaynama_not =
| çözünürlük =
<!-- Farmakokinetik özellikler -->
| biyoyararlanım =
| proteine_bağlanma =
| metabolizma =
| yarılanma_ömrü =
| atılma =
<!------ Tedavi bilgileri ------->
<!--- Gebelik kategorisi --->
| GK-ABD = POM
| GK-Avustralya = U
| GK-diğer =
<!----- Uygulama yolu ------>
| uygulama_yolu =
}}
'''''Amisülpirid''''', [[antipsikotik]] bir [[ilaç]]tır. [[Psikoz]]ların [[tedavi]]sinde kullanılmaktadır. (Solian<sup>®</sup>, Amitrex<sup>®</sup> ticari isimleri vardır). Ağızdan alınan ([[oral]] [[solüsyon]] bir [[ilaç]]tır. Piyasada 100&nbsp;mg'lık, 200&nbsp;mg'lık ve 400&nbsp;mg'lık türleri bulunmaktadır. <!--İlacın yardımcı maddeleri arasında [[gesweet]], [[hidroklorik asit]], [[metil parahidroksibenzoat]], [[propil parahidroksibenzoat]], [[potasyum sorbat]], [[karamel|karamel aroması]] ve [[su|saf su]] yer almaktadır.-->
 
14.848

değişiklik